N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
Compound characteristics
| Compound ID: | E920-1025 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| Molecular Weight: | 317.39 |
| Molecular Formula: | C17 H23 N3 O3 |
| Smiles: | CN(C)CCN(Cc1ccco1)C(c1c2CCCCc2on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.02 |
| logD: | 1.2195 |
| logSw: | -2.2023 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.442 |
| InChI Key: | VQDXOFDWJAACIG-UHFFFAOYSA-N |