2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-phenyl-1H-indene-1,3(2H)-dione
Chemical Structure Depiction of
2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-phenyl-1H-indene-1,3(2H)-dione
2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-phenyl-1H-indene-1,3(2H)-dione
Compound characteristics
| Compound ID: | E938-0141 |
| Compound Name: | 2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-phenyl-1H-indene-1,3(2H)-dione |
| Molecular Weight: | 371.39 |
| Molecular Formula: | C23 H17 N O4 |
| Smiles: | C1COc2cc(ccc2O1)NC1(C(c2ccccc2C1=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5495 |
| logD: | 3.5495 |
| logSw: | -3.8845 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.956 |
| InChI Key: | GRKTWNGDQUGRCO-UHFFFAOYSA-N |