ethyl 4-{[(4-ethylphenyl)methyl]amino}-6-methylfuro[2,3-d]pyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(4-ethylphenyl)methyl]amino}-6-methylfuro[2,3-d]pyrimidine-5-carboxylate
ethyl 4-{[(4-ethylphenyl)methyl]amino}-6-methylfuro[2,3-d]pyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | E946-0184 |
| Compound Name: | ethyl 4-{[(4-ethylphenyl)methyl]amino}-6-methylfuro[2,3-d]pyrimidine-5-carboxylate |
| Molecular Weight: | 339.39 |
| Molecular Formula: | C19 H21 N3 O3 |
| Smiles: | CCc1ccc(CNc2c3c(C(=O)OCC)c(C)oc3ncn2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.7995 |
| logD: | 3.7995 |
| logSw: | -4.3153 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.797 |
| InChI Key: | SIVSRAVYIMBPHH-UHFFFAOYSA-N |