N-(2-fluorophenyl)-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-(2-fluorophenyl)-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0020 |
| Compound Name: | N-(2-fluorophenyl)-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 301.27 |
| Molecular Formula: | C15 H12 F N3 O3 |
| Smiles: | Cc1c(C(Nc2ccccc2F)=O)c2C(N(C)C=Nc2o1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1618 |
| logD: | 1.1535 |
| logSw: | -2.0476 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.102 |
| InChI Key: | HQHCASCWPUTRKF-UHFFFAOYSA-N |