N-[(2-ethoxyphenyl)methyl]-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-[(2-ethoxyphenyl)methyl]-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0168 |
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-3,6-dimethyl-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 341.36 |
| Molecular Formula: | C18 H19 N3 O4 |
| Smiles: | CCOc1ccccc1CNC(c1c2C(N(C)C=Nc2oc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3319 |
| logD: | 1.3319 |
| logSw: | -2.1007 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.332 |
| InChI Key: | HZYQRDSGYAJDRK-UHFFFAOYSA-N |