N-(4-ethoxyphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-(4-ethoxyphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0488 |
| Compound Name: | N-(4-ethoxyphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 369.42 |
| Molecular Formula: | C20 H23 N3 O4 |
| Smiles: | CCOc1ccc(cc1)NC(c1c2C(N(CC(C)C)C=Nc2oc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1042 |
| logD: | 3.1039 |
| logSw: | -3.4514 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.208 |
| InChI Key: | LXXKEDNWSXEECH-UHFFFAOYSA-N |