N-[(furan-2-yl)methyl]-6-methyl-N-(3-methylbutyl)-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-6-methyl-N-(3-methylbutyl)-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-[(furan-2-yl)methyl]-6-methyl-N-(3-methylbutyl)-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0710 |
| Compound Name: | N-[(furan-2-yl)methyl]-6-methyl-N-(3-methylbutyl)-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C22 H29 N3 O4 |
| Smiles: | CC(C)CCN(Cc1ccco1)C(c1c2C(N(CC(C)C)C=Nc2oc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6431 |
| logD: | 3.6431 |
| logSw: | -3.9548 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.931 |
| InChI Key: | RDFAZNCDBCYING-UHFFFAOYSA-N |