N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0712 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-N-[(furan-2-yl)methyl]-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C21 H28 N4 O4 |
| Smiles: | CC(C)CN1C=Nc2c(C1=O)c(C(N(CCN(C)C)Cc1ccco1)=O)c(C)o2 |
| Stereo: | ACHIRAL |
| logP: | 1.9172 |
| logD: | 1.3801 |
| logSw: | -2.2178 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.797 |
| InChI Key: | LCGXGUQFTSBXQI-UHFFFAOYSA-N |