N-(2,5-dimethylphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
N-(2,5-dimethylphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E947-0763 |
| Compound Name: | N-(2,5-dimethylphenyl)-6-methyl-3-(2-methylpropyl)-4-oxo-3,4-dihydrofuro[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 353.42 |
| Molecular Formula: | C20 H23 N3 O3 |
| Smiles: | CC(C)CN1C=Nc2c(C1=O)c(C(Nc1cc(C)ccc1C)=O)c(C)o2 |
| Stereo: | ACHIRAL |
| logP: | 2.9746 |
| logD: | 2.9745 |
| logSw: | -3.1158 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.386 |
| InChI Key: | JJIRLLXABUMLDK-UHFFFAOYSA-N |