N-(4-chloro-2-methylphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
N-(4-chloro-2-methylphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E948-0821 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 386.84 |
| Molecular Formula: | C19 H19 Cl N4 O3 |
| Smiles: | Cc1cc(ccc1NC(c1c2c(ncnc2oc1C)N1CCOCC1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7987 |
| logD: | 3.7986 |
| logSw: | -4.7183 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.856 |
| InChI Key: | FKGNWQZPOGOQJA-UHFFFAOYSA-N |