N-(3,5-dimethoxyphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
N-(3,5-dimethoxyphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E948-0829 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-6-methyl-4-(morpholin-4-yl)furo[2,3-d]pyrimidine-5-carboxamide |
| Molecular Weight: | 398.42 |
| Molecular Formula: | C20 H22 N4 O5 |
| Smiles: | Cc1c(C(Nc2cc(cc(c2)OC)OC)=O)c2c(ncnc2o1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 2.8788 |
| logD: | 2.8787 |
| logSw: | -3.3842 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.642 |
| InChI Key: | PNICCXYQHXSVMK-UHFFFAOYSA-N |