tert-butyl 4-[4-(cyclohexylcarbamoyl)-1-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-[4-(cyclohexylcarbamoyl)-1-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
tert-butyl 4-[4-(cyclohexylcarbamoyl)-1-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E951-0045 |
| Compound Name: | tert-butyl 4-[4-(cyclohexylcarbamoyl)-1-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| Molecular Weight: | 470.59 |
| Molecular Formula: | C26 H35 F N4 O3 |
| Smiles: | CC(C)(C)OC(N1CCC(CC1)c1c(cnn1c1ccc(cc1)F)C(NC1CCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.2851 |
| logD: | 6.2851 |
| logSw: | -5.2876 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.282 |
| InChI Key: | BVXDLYSXUVPZGF-UHFFFAOYSA-N |