tert-butyl 4-{1-(4-chlorophenyl)-4-[({1-[(4-methylphenyl)methyl]piperidin-4-yl}methyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-{1-(4-chlorophenyl)-4-[({1-[(4-methylphenyl)methyl]piperidin-4-yl}methyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
tert-butyl 4-{1-(4-chlorophenyl)-4-[({1-[(4-methylphenyl)methyl]piperidin-4-yl}methyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E951-0570 |
| Compound Name: | tert-butyl 4-{1-(4-chlorophenyl)-4-[({1-[(4-methylphenyl)methyl]piperidin-4-yl}methyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate |
| Molecular Weight: | 606.21 |
| Molecular Formula: | C34 H44 Cl N5 O3 |
| Smiles: | Cc1ccc(CN2CCC(CC2)CNC(c2cnn(c3ccc(cc3)[Cl])c2C2CCN(CC2)C(=O)OC(C)(C)C)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 7.5538 |
| logD: | 4.8328 |
| logSw: | -6.3166 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.289 |
| InChI Key: | NREJDIFQLLGVIE-UHFFFAOYSA-N |