tert-butyl 4-{4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-(4-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-{4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-(4-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
tert-butyl 4-{4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-(4-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E951-0871 |
| Compound Name: | tert-butyl 4-{4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-(4-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate |
| Molecular Weight: | 547.67 |
| Molecular Formula: | C31 H38 F N5 O3 |
| Smiles: | Cc1ccc(cc1)n1c(C2CCN(CC2)C(=O)OC(C)(C)C)c(cn1)C(N1CCN(CC1)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 6.3809 |
| logD: | 6.3809 |
| logSw: | -5.4772 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.052 |
| InChI Key: | BRMZCJFEJJVXJJ-UHFFFAOYSA-N |