tert-butyl 4-[1-phenyl-4-(4-phenylpiperazine-1-carbonyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-[1-phenyl-4-(4-phenylpiperazine-1-carbonyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
tert-butyl 4-[1-phenyl-4-(4-phenylpiperazine-1-carbonyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E951-0931 |
| Compound Name: | tert-butyl 4-[1-phenyl-4-(4-phenylpiperazine-1-carbonyl)-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| Molecular Weight: | 515.66 |
| Molecular Formula: | C30 H37 N5 O3 |
| Smiles: | CC(C)(C)OC(N1CCC(CC1)c1c(cnn1c1ccccc1)C(N1CCN(CC1)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6854 |
| logD: | 5.6854 |
| logSw: | -5.4194 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.052 |
| InChI Key: | LMRCDTOGLASCIA-UHFFFAOYSA-N |