tert-butyl 4-[4-(4-ethylpiperazine-1-carbonyl)-1-phenyl-1H-pyrazol-5-yl]piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-[4-(4-ethylpiperazine-1-carbonyl)-1-phenyl-1H-pyrazol-5-yl]piperidine-1-carboxylate
tert-butyl 4-[4-(4-ethylpiperazine-1-carbonyl)-1-phenyl-1H-pyrazol-5-yl]piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E951-1022 |
| Compound Name: | tert-butyl 4-[4-(4-ethylpiperazine-1-carbonyl)-1-phenyl-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| Molecular Weight: | 467.61 |
| Molecular Formula: | C26 H37 N5 O3 |
| Smiles: | CCN1CCN(CC1)C(c1cnn(c2ccccc2)c1C1CCN(CC1)C(=O)OC(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2129 |
| logD: | 4.0367 |
| logSw: | -4.0266 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.328 |
| InChI Key: | MYHNKFHXIXLYMO-UHFFFAOYSA-N |