1-benzyl-3-{[(3-methoxypropyl)amino]methylidene}-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
Chemical Structure Depiction of
1-benzyl-3-{[(3-methoxypropyl)amino]methylidene}-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
1-benzyl-3-{[(3-methoxypropyl)amino]methylidene}-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
Compound characteristics
| Compound ID: | E953-0054 |
| Compound Name: | 1-benzyl-3-{[(3-methoxypropyl)amino]methylidene}-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione |
| Molecular Weight: | 392.49 |
| Molecular Formula: | C18 H20 N2 O4 S2 |
| Smiles: | COCCCN/C=C1/C(c2c(ccs2)N(Cc2ccccc2)S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1932 |
| logD: | 2.1932 |
| logSw: | -2.7605 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.515 |
| InChI Key: | QSPGINOWQHVEQD-UHFFFAOYSA-N |