1-[(4-fluorophenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methylidene)-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
Chemical Structure Depiction of
1-[(4-fluorophenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methylidene)-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
1-[(4-fluorophenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methylidene)-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
Compound characteristics
| Compound ID: | E953-0325 |
| Compound Name: | 1-[(4-fluorophenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methylidene)-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione |
| Molecular Weight: | 418.46 |
| Molecular Formula: | C19 H15 F N2 O4 S2 |
| Smiles: | C(c1ccco1)N/C=C1/C(c2c(ccs2)N(Cc2ccc(cc2)F)S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9109 |
| logD: | 2.9109 |
| logSw: | -3.4553 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.808 |
| InChI Key: | WPWXPNKVTCYFDT-UHFFFAOYSA-N |