3-[(2,5-dimethylanilino)methylidene]-1-[(3-fluorophenyl)methyl]-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
					Chemical Structure Depiction of
3-[(2,5-dimethylanilino)methylidene]-1-[(3-fluorophenyl)methyl]-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
			3-[(2,5-dimethylanilino)methylidene]-1-[(3-fluorophenyl)methyl]-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione
Compound characteristics
| Compound ID: | E953-0438 | 
| Compound Name: | 3-[(2,5-dimethylanilino)methylidene]-1-[(3-fluorophenyl)methyl]-2lambda~6~-thieno[3,2-c][1,2]thiazine-2,2,4(1H,3H)-trione | 
| Molecular Weight: | 442.53 | 
| Molecular Formula: | C22 H19 F N2 O3 S2 | 
| Smiles: | Cc1ccc(C)c(c1)N/C=C1/C(c2c(ccs2)N(Cc2cccc(c2)F)S1(=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.6449 | 
| logD: | 4.6449 | 
| logSw: | -4.4729 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 55.83 | 
| InChI Key: | JWQWPTXMXXAZQA-UHFFFAOYSA-N | 
 
				 
				