tert-butyl 4-{4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-1-(3-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-{4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-1-(3-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
tert-butyl 4-{4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-1-(3-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E955-0475 |
| Compound Name: | tert-butyl 4-{4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-1-(3-methylphenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate |
| Molecular Weight: | 557.74 |
| Molecular Formula: | C33 H43 N5 O3 |
| Smiles: | Cc1cccc(c1)n1c(C2CCN(CC2)C(=O)OC(C)(C)C)c(cn1)C(N1CCN(CC1)c1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 7.4583 |
| logD: | 7.4583 |
| logSw: | -5.5236 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.751 |
| InChI Key: | SVUKFMDPELGCFJ-UHFFFAOYSA-N |