tert-butyl 4-[1-(2-chlorophenyl)-4-{[(3-methoxyphenyl)methyl]carbamoyl}-1H-pyrazol-5-yl]piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-[1-(2-chlorophenyl)-4-{[(3-methoxyphenyl)methyl]carbamoyl}-1H-pyrazol-5-yl]piperidine-1-carboxylate
tert-butyl 4-[1-(2-chlorophenyl)-4-{[(3-methoxyphenyl)methyl]carbamoyl}-1H-pyrazol-5-yl]piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E955-1484 |
| Compound Name: | tert-butyl 4-[1-(2-chlorophenyl)-4-{[(3-methoxyphenyl)methyl]carbamoyl}-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| Molecular Weight: | 525.05 |
| Molecular Formula: | C28 H33 Cl N4 O4 |
| Smiles: | CC(C)(C)OC(N1CCC(CC1)c1c(cnn1c1ccccc1[Cl])C(NCc1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4266 |
| logD: | 6.4266 |
| logSw: | -6.1064 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.799 |
| InChI Key: | WNBFTXHJVTXSFE-UHFFFAOYSA-N |