tert-butyl 4-{4-[(2,3-dichlorophenyl)carbamoyl]-1-(4-fluorophenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-{4-[(2,3-dichlorophenyl)carbamoyl]-1-(4-fluorophenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
tert-butyl 4-{4-[(2,3-dichlorophenyl)carbamoyl]-1-(4-fluorophenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E955-1706 |
| Compound Name: | tert-butyl 4-{4-[(2,3-dichlorophenyl)carbamoyl]-1-(4-fluorophenyl)-1H-pyrazol-5-yl}piperidine-1-carboxylate |
| Molecular Weight: | 533.43 |
| Molecular Formula: | C26 H27 Cl2 F N4 O3 |
| Smiles: | CC(C)(C)OC(N1CCC(CC1)c1c(cnn1c1ccc(cc1)F)C(Nc1cccc(c1[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.1732 |
| logD: | 6.9991 |
| logSw: | -6.4912 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.536 |
| InChI Key: | UXLXQXPZCYMOMV-UHFFFAOYSA-N |