tert-butyl 4-{1-(3-chloro-2-methylphenyl)-4-[(3-fluoro-4-methylphenyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
Chemical Structure Depiction of
tert-butyl 4-{1-(3-chloro-2-methylphenyl)-4-[(3-fluoro-4-methylphenyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
tert-butyl 4-{1-(3-chloro-2-methylphenyl)-4-[(3-fluoro-4-methylphenyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E955-2205 |
| Compound Name: | tert-butyl 4-{1-(3-chloro-2-methylphenyl)-4-[(3-fluoro-4-methylphenyl)carbamoyl]-1H-pyrazol-5-yl}piperidine-1-carboxylate |
| Molecular Weight: | 527.04 |
| Molecular Formula: | C28 H32 Cl F N4 O3 |
| Smiles: | Cc1ccc(cc1F)NC(c1cnn(c2cccc(c2C)[Cl])c1C1CCN(CC1)C(=O)OC(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 7.6312 |
| logD: | 7.6275 |
| logSw: | -6.4046 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.933 |
| InChI Key: | IQARRXQNGZRHDF-UHFFFAOYSA-N |