N-(2-{4-[(3-ethoxypropyl)(methyl)amino]piperidine-1-carbonyl}-1-benzofuran-3-yl)-2-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
N-(2-{4-[(3-ethoxypropyl)(methyl)amino]piperidine-1-carbonyl}-1-benzofuran-3-yl)-2-(4-fluorophenyl)acetamide
N-(2-{4-[(3-ethoxypropyl)(methyl)amino]piperidine-1-carbonyl}-1-benzofuran-3-yl)-2-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | E957-0418 |
| Compound Name: | N-(2-{4-[(3-ethoxypropyl)(methyl)amino]piperidine-1-carbonyl}-1-benzofuran-3-yl)-2-(4-fluorophenyl)acetamide |
| Molecular Weight: | 495.59 |
| Molecular Formula: | C28 H34 F N3 O4 |
| Smiles: | CCOCCCN(C)C1CCN(CC1)C(c1c(c2ccccc2o1)NC(Cc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4997 |
| logD: | 0.4919 |
| logSw: | -3.6381 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.718 |
| InChI Key: | OMXJFUOCLDBLMA-UHFFFAOYSA-N |