2-methoxy-N-{2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
Chemical Structure Depiction of
2-methoxy-N-{2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
2-methoxy-N-{2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
Compound characteristics
| Compound ID: | E957-1203 |
| Compound Name: | 2-methoxy-N-{2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide |
| Molecular Weight: | 423.47 |
| Molecular Formula: | C23 H25 N3 O5 |
| Smiles: | COCC(Nc1c2ccccc2oc1C(N1CCN(CC1)c1ccccc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5957 |
| logD: | 2.5763 |
| logSw: | -3.1092 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.18 |
| InChI Key: | AOBMLIVVDNEITP-UHFFFAOYSA-N |