N,N-dipropyl-3-[3-(thiophen-2-yl)prop-2-enamido]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N,N-dipropyl-3-[3-(thiophen-2-yl)prop-2-enamido]-1-benzofuran-2-carboxamide
N,N-dipropyl-3-[3-(thiophen-2-yl)prop-2-enamido]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | E957-2566 |
| Compound Name: | N,N-dipropyl-3-[3-(thiophen-2-yl)prop-2-enamido]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 396.51 |
| Molecular Formula: | C22 H24 N2 O3 S |
| Smiles: | CCCN(CCC)C(c1c(c2ccccc2o1)NC(/C=C/c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7404 |
| logD: | 4.7039 |
| logSw: | -4.5765 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.704 |
| InChI Key: | LCXUOSOKSPDNQQ-UHFFFAOYSA-N |