4-fluoro-N-({1-[5-(morpholin-4-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrol-2-yl}methyl)aniline
Chemical Structure Depiction of
4-fluoro-N-({1-[5-(morpholin-4-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrol-2-yl}methyl)aniline
4-fluoro-N-({1-[5-(morpholin-4-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrol-2-yl}methyl)aniline
Compound characteristics
| Compound ID: | E958-1374 |
| Compound Name: | 4-fluoro-N-({1-[5-(morpholin-4-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrol-2-yl}methyl)aniline |
| Molecular Weight: | 359.42 |
| Molecular Formula: | C17 H18 F N5 O S |
| Smiles: | C(c1cccn1c1nnc(N2CCOCC2)s1)Nc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.2144 |
| logD: | 3.2144 |
| logSw: | -3.2447 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.497 |
| InChI Key: | VXKNQOWYDUOHET-UHFFFAOYSA-N |