6-{5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]furan-2-yl}pyridazin-3(2H)-one
Chemical Structure Depiction of
6-{5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]furan-2-yl}pyridazin-3(2H)-one
6-{5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]furan-2-yl}pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | E959-1813 |
| Compound Name: | 6-{5-[4-(4-methoxyphenyl)piperazine-1-sulfonyl]furan-2-yl}pyridazin-3(2H)-one |
| Molecular Weight: | 416.45 |
| Molecular Formula: | C19 H20 N4 O5 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)S(c1ccc(C2C=CC(NN=2)=O)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5567 |
| logD: | 2.5564 |
| logSw: | -2.9267 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.782 |
| InChI Key: | BVGSNXRGVVHCOG-UHFFFAOYSA-N |