N-(4-fluorophenyl)-2-oxo-3-(propan-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-oxo-3-(propan-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonamide
N-(4-fluorophenyl)-2-oxo-3-(propan-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonamide
Compound characteristics
| Compound ID: | E966-0473 |
| Compound Name: | N-(4-fluorophenyl)-2-oxo-3-(propan-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonamide |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C17 H15 F N2 O3 S |
| Smiles: | CC(C)=C1C(Nc2ccc(cc12)S(Nc1ccc(cc1)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2489 |
| logD: | 3.1252 |
| logSw: | -3.6439 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.132 |
| InChI Key: | ZKKDGUCLDSERFQ-UHFFFAOYSA-N |