N-(2-chloro-4-methylphenyl)-6-cyclopropyl-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
N-(2-chloro-4-methylphenyl)-6-cyclopropyl-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
N-(2-chloro-4-methylphenyl)-6-cyclopropyl-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | E981-2146 |
| Compound Name: | N-(2-chloro-4-methylphenyl)-6-cyclopropyl-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 416.91 |
| Molecular Formula: | C24 H21 Cl N4 O |
| Smiles: | Cc1ccc(c(c1)[Cl])NC(c1cc(C2CC2)nc2c1c(C)nn2c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6977 |
| logD: | 5.6888 |
| logSw: | -5.9192 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.279 |
| InChI Key: | WJZPVNMWABFOIP-UHFFFAOYSA-N |