N-(3-bromophenyl)-N'-{[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]methyl}urea
Chemical Structure Depiction of
N-(3-bromophenyl)-N'-{[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]methyl}urea
N-(3-bromophenyl)-N'-{[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]methyl}urea
Compound characteristics
| Compound ID: | E983-1243 |
| Compound Name: | N-(3-bromophenyl)-N'-{[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]methyl}urea |
| Molecular Weight: | 412.33 |
| Molecular Formula: | C21 H22 Br N3 O |
| Smiles: | Cc1ccc(cc1)n1c(C)cc(CNC(Nc2cccc(c2)[Br])=O)c1C |
| Stereo: | ACHIRAL |
| logP: | 5.1612 |
| logD: | 5.1612 |
| logSw: | -5.001 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.528 |
| InChI Key: | SWKPRFVREUXRMI-UHFFFAOYSA-N |