N-(butan-2-yl)-N'-{[1-(2-methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methyl}urea
Chemical Structure Depiction of
N-(butan-2-yl)-N'-{[1-(2-methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methyl}urea
N-(butan-2-yl)-N'-{[1-(2-methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methyl}urea
Compound characteristics
| Compound ID: | E983-1922 |
| Compound Name: | N-(butan-2-yl)-N'-{[1-(2-methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methyl}urea |
| Molecular Weight: | 329.44 |
| Molecular Formula: | C19 H27 N3 O2 |
| Smiles: | CCC(C)NC(NCc1cc(C)n(c2ccccc2OC)c1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7511 |
| logD: | 2.7511 |
| logSw: | -3.2325 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.893 |
| InChI Key: | MYDHHPGHEPEXEY-ZDUSSCGKSA-N |