4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxo-N-[(thiophen-2-yl)methyl]butanamide
Chemical Structure Depiction of
4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxo-N-[(thiophen-2-yl)methyl]butanamide
4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxo-N-[(thiophen-2-yl)methyl]butanamide
Compound characteristics
| Compound ID: | E986-0883 |
| Compound Name: | 4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxo-N-[(thiophen-2-yl)methyl]butanamide |
| Molecular Weight: | 423.49 |
| Molecular Formula: | C22 H21 N3 O4 S |
| Smiles: | COc1cccc2CN(C(CCC(NCc3cccs3)=O)=O)c3cccnc3Oc12 |
| Stereo: | ACHIRAL |
| logP: | 2.8779 |
| logD: | 2.8779 |
| logSw: | -3.4397 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.953 |
| InChI Key: | IADVYMZRCDGVER-UHFFFAOYSA-N |