3-(2,4-dimethylbenzoyl)-1-[(4-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
Chemical Structure Depiction of
3-(2,4-dimethylbenzoyl)-1-[(4-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
3-(2,4-dimethylbenzoyl)-1-[(4-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
Compound characteristics
| Compound ID: | E999-1679 |
| Compound Name: | 3-(2,4-dimethylbenzoyl)-1-[(4-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one |
| Molecular Weight: | 400.45 |
| Molecular Formula: | C25 H21 F N2 O2 |
| Smiles: | Cc1ccc(C(C2=CN(Cc3ccc(cc3)F)c3c(ccc(C)n3)C2=O)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.5863 |
| logD: | 5.5863 |
| logSw: | -5.3374 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.735 |
| InChI Key: | KNGXPMIZEUIZPP-UHFFFAOYSA-N |