2-{[5-(4-chlorophenyl)-4-(3,4-dimethylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(3-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-{[5-(4-chlorophenyl)-4-(3,4-dimethylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(3-methoxyphenyl)acetamide
2-{[5-(4-chlorophenyl)-4-(3,4-dimethylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(3-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | F019-0436 |
| Compound Name: | 2-{[5-(4-chlorophenyl)-4-(3,4-dimethylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(3-methoxyphenyl)acetamide |
| Molecular Weight: | 479 |
| Molecular Formula: | C25 H23 Cl N4 O2 S |
| Smiles: | Cc1ccc(cc1C)n1c(c2ccc(cc2)[Cl])nnc1SCC(Nc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5505 |
| logD: | 6.5505 |
| logSw: | -6.3652 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.406 |
| InChI Key: | NZQITZPLLWOFTR-UHFFFAOYSA-N |