1-[7-(4-chlorophenyl)-5-phenyl-6,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-4(5H)-yl]ethan-1-one
Chemical Structure Depiction of
1-[7-(4-chlorophenyl)-5-phenyl-6,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-4(5H)-yl]ethan-1-one
1-[7-(4-chlorophenyl)-5-phenyl-6,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-4(5H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | F019-2854 |
| Compound Name: | 1-[7-(4-chlorophenyl)-5-phenyl-6,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-4(5H)-yl]ethan-1-one |
| Molecular Weight: | 352.82 |
| Molecular Formula: | C19 H17 Cl N4 O |
| Smiles: | CC(N1C(CC(c2ccc(cc2)[Cl])n2c1ncn2)c1ccccc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6802 |
| logD: | 3.6802 |
| logSw: | -4.2712 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.978 |
| InChI Key: | UVRPRLGPTPWTBL-UHFFFAOYSA-N |