[4-(3-chlorophenyl)piperazin-1-yl]{1-[(2-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridin-4-yl}methanone
Chemical Structure Depiction of
[4-(3-chlorophenyl)piperazin-1-yl]{1-[(2-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridin-4-yl}methanone
[4-(3-chlorophenyl)piperazin-1-yl]{1-[(2-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridin-4-yl}methanone
Compound characteristics
| Compound ID: | F033-0010 |
| Compound Name: | [4-(3-chlorophenyl)piperazin-1-yl]{1-[(2-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridin-4-yl}methanone |
| Molecular Weight: | 413.92 |
| Molecular Formula: | C23 H25 Cl F N3 O |
| Smiles: | C1CN(CC=C1C(N1CCN(CC1)c1cccc(c1)[Cl])=O)Cc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 4.4066 |
| logD: | 0.2737 |
| logSw: | -4.5271 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.8796 |
| InChI Key: | RTSQGHSMMUXBGH-UHFFFAOYSA-N |