N-(cyclohexylmethyl)-1-[(3-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridine-4-carboxamide
Chemical Structure Depiction of
N-(cyclohexylmethyl)-1-[(3-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridine-4-carboxamide
N-(cyclohexylmethyl)-1-[(3-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridine-4-carboxamide
Compound characteristics
| Compound ID: | F033-2889 |
| Compound Name: | N-(cyclohexylmethyl)-1-[(3-fluorophenyl)methyl]-1,2,3,6-tetrahydropyridine-4-carboxamide |
| Molecular Weight: | 330.44 |
| Molecular Formula: | C20 H27 F N2 O |
| Smiles: | C1CCC(CC1)CNC(C1CCN(CC=1)Cc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1137 |
| logD: | 1.2779 |
| logSw: | -4.1841 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.5765 |
| InChI Key: | MOOKXAKXOBGLEX-UHFFFAOYSA-N |