N-[(4-fluorophenyl)methyl]-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}acetamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}acetamide
N-[(4-fluorophenyl)methyl]-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | F034-0240 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}acetamide |
| Molecular Weight: | 357.4 |
| Molecular Formula: | C18 H16 F N3 O2 S |
| Smiles: | C(c1ccc(cc1)F)NC(CSCc1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.916 |
| logD: | 3.916 |
| logSw: | -4.0883 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.781 |
| InChI Key: | KXDGCDHJRDJHSP-UHFFFAOYSA-N |