N-(4-ethylphenyl)-2-({[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-2-({[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
N-(4-ethylphenyl)-2-({[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | F034-0329 |
| Compound Name: | N-(4-ethylphenyl)-2-({[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide |
| Molecular Weight: | 367.47 |
| Molecular Formula: | C20 H21 N3 O2 S |
| Smiles: | CCc1ccc(cc1)NC(CSCc1nc(c2ccc(C)cc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6647 |
| logD: | 5.6647 |
| logSw: | -5.3802 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.459 |
| InChI Key: | UQTFEQQJEPBSGU-UHFFFAOYSA-N |