2-({[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-N-(3-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-({[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-N-(3-methoxyphenyl)acetamide
2-({[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-N-(3-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | F034-0405 |
| Compound Name: | 2-({[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-N-(3-methoxyphenyl)acetamide |
| Molecular Weight: | 373.4 |
| Molecular Formula: | C18 H16 F N3 O3 S |
| Smiles: | COc1cccc(c1)NC(CSCc1nc(c2ccc(cc2)F)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4062 |
| logD: | 4.4062 |
| logSw: | -4.3741 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.003 |
| InChI Key: | CRVRGXGWDVVDSY-UHFFFAOYSA-N |