N-(2,6-dimethylphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
N-(2,6-dimethylphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | F034-0523 |
| Compound Name: | N-(2,6-dimethylphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide |
| Molecular Weight: | 383.47 |
| Molecular Formula: | C20 H21 N3 O3 S |
| Smiles: | Cc1cccc(C)c1NC(CSCc1nc(c2ccc(cc2)OC)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4778 |
| logD: | 4.4777 |
| logSw: | -4.292 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.607 |
| InChI Key: | NMWCFJJLXSWZAQ-UHFFFAOYSA-N |