2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-1-(2-methylpiperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-1-(2-methylpiperidin-1-yl)ethan-1-one
2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-1-(2-methylpiperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | F034-0716 |
| Compound Name: | 2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-1-(2-methylpiperidin-1-yl)ethan-1-one |
| Molecular Weight: | 365.88 |
| Molecular Formula: | C17 H20 Cl N3 O2 S |
| Smiles: | CC1CCCCN1C(CSCc1nc(c2ccc(cc2)[Cl])no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4301 |
| logD: | 4.4301 |
| logSw: | -4.5855 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.987 |
| InChI Key: | GQZLBJSIMHUMJO-LBPRGKRZSA-N |