{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(4-phenylpiperazin-1-yl)methanone
{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | F035-0294 |
| Compound Name: | {1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 491.59 |
| Molecular Formula: | C27 H33 N5 O4 |
| Smiles: | CCOc1ccc(cc1OC)c1nc(N2CCC(CC2)C(N2CCN(CC2)c2ccccc2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.0112 |
| logD: | 4.0111 |
| logSw: | -4.1447 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 70.189 |
| InChI Key: | CBODDKUECPPNTJ-UHFFFAOYSA-N |