{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(piperidin-1-yl)methanone
Chemical Structure Depiction of
{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(piperidin-1-yl)methanone
{1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | F035-0319 |
| Compound Name: | {1-[3-(4-ethoxy-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl}(piperidin-1-yl)methanone |
| Molecular Weight: | 414.5 |
| Molecular Formula: | C22 H30 N4 O4 |
| Smiles: | CCOc1ccc(cc1OC)c1nc(N2CCC(CC2)C(N2CCCCC2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.3759 |
| logD: | 3.3759 |
| logSw: | -3.4031 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 66.929 |
| InChI Key: | DUCGHPCOIVEBIW-UHFFFAOYSA-N |