N-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N'-(3,4,5-trimethoxyphenyl)urea
Chemical Structure Depiction of
N-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N'-(3,4,5-trimethoxyphenyl)urea
N-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N'-(3,4,5-trimethoxyphenyl)urea
Compound characteristics
| Compound ID: | F039-0042 |
| Compound Name: | N-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N'-(3,4,5-trimethoxyphenyl)urea |
| Molecular Weight: | 336.3 |
| Molecular Formula: | C14 H16 N4 O6 |
| Smiles: | COc1cc(cc(c1OC)OC)NC(NC1=CNC(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.025 |
| logD: | -1.4097 |
| logSw: | -1.825 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 105.254 |
| InChI Key: | XCPKLKVBRBBNQJ-UHFFFAOYSA-N |