N-(4-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-1,3-thiazol-2-yl)-N'-phenylurea
Chemical Structure Depiction of
N-(4-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-1,3-thiazol-2-yl)-N'-phenylurea
N-(4-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-1,3-thiazol-2-yl)-N'-phenylurea
Compound characteristics
| Compound ID: | F042-0018 |
| Compound Name: | N-(4-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-1,3-thiazol-2-yl)-N'-phenylurea |
| Molecular Weight: | 439.51 |
| Molecular Formula: | C22 H22 F N5 O2 S |
| Smiles: | C(C(N1CCN(CC1)c1ccc(cc1)F)=O)c1csc(NC(Nc2ccccc2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.13 |
| logD: | 4.1297 |
| logSw: | -4.175 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.464 |
| InChI Key: | VFFZBYDBCOHUEZ-UHFFFAOYSA-N |