N-(3,5-dimethylphenyl)-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
N-(3,5-dimethylphenyl)-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
Compound characteristics
| Compound ID: | F042-0102 |
| Compound Name: | N-(3,5-dimethylphenyl)-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide |
| Molecular Weight: | 380.47 |
| Molecular Formula: | C20 H20 N4 O2 S |
| Smiles: | Cc1cc(C)cc(c1)NC(Cc1csc(NC(Nc2ccccc2)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7285 |
| logD: | 4.7282 |
| logSw: | -4.5117 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.961 |
| InChI Key: | DYOGKUFCKORNAV-UHFFFAOYSA-N |