N-[2-(1H-indol-3-yl)ethyl]-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
Chemical Structure Depiction of
N-[2-(1H-indol-3-yl)ethyl]-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
N-[2-(1H-indol-3-yl)ethyl]-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide
Compound characteristics
| Compound ID: | F042-0135 |
| Compound Name: | N-[2-(1H-indol-3-yl)ethyl]-2-[2-(phenylcarbamamido)-1,3-thiazol-4-yl]acetamide |
| Molecular Weight: | 419.5 |
| Molecular Formula: | C22 H21 N5 O2 S |
| Smiles: | C(CNC(Cc1csc(NC(Nc2ccccc2)=O)n1)=O)c1c[nH]c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.8239 |
| logD: | 3.8236 |
| logSw: | -4.2058 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 76.995 |
| InChI Key: | GPBRNDRPKTVDPC-UHFFFAOYSA-N |