2-{2-[(4-chlorophenyl)carbamamido]-1,3-thiazol-4-yl}-N-(4-phenoxyphenyl)acetamide
Chemical Structure Depiction of
2-{2-[(4-chlorophenyl)carbamamido]-1,3-thiazol-4-yl}-N-(4-phenoxyphenyl)acetamide
2-{2-[(4-chlorophenyl)carbamamido]-1,3-thiazol-4-yl}-N-(4-phenoxyphenyl)acetamide
Compound characteristics
| Compound ID: | F042-0499 |
| Compound Name: | 2-{2-[(4-chlorophenyl)carbamamido]-1,3-thiazol-4-yl}-N-(4-phenoxyphenyl)acetamide |
| Molecular Weight: | 478.96 |
| Molecular Formula: | C24 H19 Cl N4 O3 S |
| Smiles: | C(C(Nc1ccc(cc1)Oc1ccccc1)=O)c1csc(NC(Nc2ccc(cc2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.5121 |
| logD: | 6.5118 |
| logSw: | -6.3997 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 72.709 |
| InChI Key: | DWAKZTDBDXJLER-UHFFFAOYSA-N |